C20H20F2N2O2 — CID 97435173
3-fluoro-N-[2-[[(E)-3-(2-fluorophenyl)but-2-enoyl]amino]ethyl]-4-methylbenzamide (PubChem CID 97435173) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[(E)-3-(2-fluorophenyl)but-2-enoyl]amino]ethyl]-4-methylbenzamide.
| Compound Name | 3-fluoro-N-[2-[[(E)-3-(2-fluorophenyl)but-2-enoyl]amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 97435173 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-fluoro-N-[2-[[(E)-3-(2-fluorophenyl)but-2-enoyl]amino]ethyl]-4-methylbenzamide |
| SMILES | C/C(=C\C(=O)NCCNC(=O)c1ccc(C)c(F)c1)c1ccccc1F |
| InChI | InChI=1S/C20H20F2N2O2/c1-13-7-8-15(12-18(13)22)20(26)24-10-9-23-19(25)11-14(2)16-5-3-4-6-17(16)21/h3-8,11-12H,9-10H2,1-2H3,(H,23,25)(H,24,26)/b14-11+ |
| InChIKey | RNRGOVKNODWXOQ-SDNWHVSQSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|