C31H26N2O5S — CID 10209036
(E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]-N-(3-nitrophenyl)sulfonylprop-2-enamide (PubChem CID 10209036) has the molecular formula C31H26N2O5S and a molecular weight of 538.63 g/mol. Its IUPAC name is (E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]-N-(3-nitrophenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]-N-(3-nitrophenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 10209036 |
| Molecular Formula | C31H26N2O5S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | (E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]-N-(3-nitrophenyl)sulfonylprop-2-enamide |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(/C=C/C(=O)NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H26N2O5S/c1-2-29(24-10-5-3-6-11-24)31(25-12-7-4-8-13-25)26-19-16-23(17-20-26)18-21-30(34)32-39(37,38)28-15-9-14-27(22-28)33(35)36/h3-22H,2H2,1H3,(H,32,34)/b21-18+,31-29- |
| InChIKey | VYNZFCGMLQOZDG-JPXVSUISSA-N |
| XLogP | 6.48 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|