C32H25NO7 — CID 69301922
(E)-3-[4-[(E)-1-[4-(4-nitrophenoxy)carbonyloxyphenyl]-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 69301922) has the molecular formula C32H25NO7 and a molecular weight of 535.55 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1-[4-(4-nitrophenoxy)carbonyloxyphenyl]-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-1-[4-(4-nitrophenoxy)carbonyloxyphenyl]-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69301922 |
| Molecular Formula | C32H25NO7 |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | (E)-3-[4-[(E)-1-[4-(4-nitrophenoxy)carbonyloxyphenyl]-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1ccc(OC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H25NO7/c1-2-29(23-6-4-3-5-7-23)31(24-11-8-22(9-12-24)10-21-30(34)35)25-13-17-27(18-14-25)39-32(36)40-28-19-15-26(16-20-28)33(37)38/h3-21H,2H2,1H3,(H,34,35)/b21-10+,31-29+ |
| InChIKey | JAHNVXSZLDFGRR-FZDSNLSESA-N |
| XLogP | 7.64 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|