C25H22O2 — CID 22144591
(E)-3-[4-[(E)-1,2-diphenylbut-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 22144591) has the molecular formula C25H22O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1,2-diphenylbut-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-1,2-diphenylbut-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22144591 |
| Molecular Formula | C25H22O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (E)-3-[4-[(E)-1,2-diphenylbut-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccccc1)c1ccc(/C=C/C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H22O2/c1-2-23(20-9-5-3-6-10-20)25(21-11-7-4-8-12-21)22-16-13-19(14-17-22)15-18-24(26)27/h3-18H,2H2,1H3,(H,26,27)/b18-15+,25-23+ |
| InChIKey | HJQQVNIORAQATK-LXFXVVTESA-N |
| XLogP | 6.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|