C26H22N2O2 — CID 66803347
(E)-3-[4-[(E)-1-imidazo[1,5-a]pyridin-7-yl-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66803347) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is (E)-3-[4-[(E)-1-imidazo[1,5-a]pyridin-7-yl-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-1-imidazo[1,5-a]pyridin-7-yl-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66803347 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (E)-3-[4-[(E)-1-imidazo[1,5-a]pyridin-7-yl-2-phenylbut-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1ccn2cncc2c1)c1ccccc1 |
| InChI | InChI=1S/C26H22N2O2/c1-2-24(20-6-4-3-5-7-20)26(22-14-15-28-18-27-17-23(28)16-22)21-11-8-19(9-12-21)10-13-25(29)30/h3-18H,2H2,1H3,(H,29,30)/b13-10+,26-24+ |
| InChIKey | CLECIDQRYCEIDP-JMTCQOQWSA-N |
| XLogP | 5.80 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|