C29H27NO2S2 — CID 142214864
(E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]-N-[(1E)-1-sulfanylbuta-1,3-dienyl]sulfinylprop-2-enamide (PubChem CID 142214864) has the molecular formula C29H27NO2S2 and a molecular weight of 485.67 g/mol. Its IUPAC name is (E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]-N-[(1E)-1-sulfanylbuta-1,3-dienyl]sulfinylprop-2-enamide.
| Compound Name | (E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]-N-[(1E)-1-sulfanylbuta-1,3-dienyl]sulfinylprop-2-enamide |
|---|---|
| PubChem CID | 142214864 |
| Molecular Formula | C29H27NO2S2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | (E)-3-[4-[(Z)-1,2-diphenylbut-1-enyl]phenyl]-N-[(1E)-1-sulfanylbuta-1,3-dienyl]sulfinylprop-2-enamide |
| SMILES | C=C/C=C(\S)S(=O)NC(=O)/C=C/c1ccc(/C(=C(/CC)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27NO2S2/c1-3-11-28(33)34(32)30-27(31)21-18-22-16-19-25(20-17-22)29(24-14-9-6-10-15-24)26(4-2)23-12-7-5-8-13-23/h3,5-21,33H,1,4H2,2H3,(H,30,31)/b21-18+,28-11+,29-26- |
| InChIKey | CICPHCAPXOMMEM-ZOBREGECSA-N |
| XLogP | 6.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|