C33H30NO7PS — CID 134999081
diethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate (PubChem CID 134999081) has the molecular formula C33H30NO7PS and a molecular weight of 615.64 g/mol. Its IUPAC name is diethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate.
| Compound Name | diethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
|---|---|
| PubChem CID | 134999081 |
| Molecular Formula | C33H30NO7PS |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | diethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)-3-(triphenyl-λ5-phosphanylidene)butanedioate |
| SMILES | CCOC(=O)C(C(C(=O)OCC)N1C(=O)c2ccccc2S1(=O)=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H30NO7PS/c1-3-40-32(36)29(34-31(35)27-22-14-15-23-28(27)43(34,38)39)30(33(37)41-4-2)42(24-16-8-5-9-17-24,25-18-10-6-11-19-25)26-20-12-7-13-21-26/h5-23,29H,3-4H2,1-2H3 |
| InChIKey | CFWXXRXLKQWIRH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|