C15H11NO5S — CID 10663280
2-phenyl-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetic acid (PubChem CID 10663280) has the molecular formula C15H11NO5S and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-phenyl-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetic acid.
| Compound Name | 2-phenyl-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 10663280 |
| Molecular Formula | C15H11NO5S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-phenyl-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C15H11NO5S/c17-14-11-8-4-5-9-12(11)22(20,21)16(14)13(15(18)19)10-6-2-1-3-7-10/h1-9,13H,(H,18,19) |
| InChIKey | AVTPROKRMRVOGR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |