C20H14ClNO3S — CID 176900604
2-[(4-chlorophenyl)-phenylmethyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 176900604) has the molecular formula C20H14ClNO3S and a molecular weight of 383.86 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-phenylmethyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[(4-chlorophenyl)-phenylmethyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 176900604 |
| Molecular Formula | C20H14ClNO3S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-[(4-chlorophenyl)-phenylmethyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1C(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14ClNO3S/c21-16-12-10-15(11-13-16)19(14-6-2-1-3-7-14)22-20(23)17-8-4-5-9-18(17)26(22,24)25/h1-13,19H |
| InChIKey | JSQWLQBHGHKNFE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |