C14H9ClN2O4S — CID 139811353
N-(4-chlorophenyl)-1,1,3-trioxo-1,2-benzothiazole-2-carboxamide (PubChem CID 139811353) has the molecular formula C14H9ClN2O4S and a molecular weight of 336.76 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1,1,3-trioxo-1,2-benzothiazole-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1,1,3-trioxo-1,2-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 139811353 |
| Molecular Formula | C14H9ClN2O4S |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | N-(4-chlorophenyl)-1,1,3-trioxo-1,2-benzothiazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C14H9ClN2O4S/c15-9-5-7-10(8-6-9)16-14(19)17-13(18)11-3-1-2-4-12(11)22(17,20)21/h1-8H,(H,16,19) |
| InChIKey | XTWAHAIYJCJLJL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |