C19H18N4O6S — CID 15270772
methyl (E)-3-[2-(phenylcarbamoyl)hydrazinyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)but-2-enoate (PubChem CID 15270772) has the molecular formula C19H18N4O6S and a molecular weight of 430.44 g/mol. Its IUPAC name is methyl (E)-3-[2-(phenylcarbamoyl)hydrazinyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)but-2-enoate.
| Compound Name | methyl (E)-3-[2-(phenylcarbamoyl)hydrazinyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)but-2-enoate |
|---|---|
| PubChem CID | 15270772 |
| Molecular Formula | C19H18N4O6S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | methyl (E)-3-[2-(phenylcarbamoyl)hydrazinyl]-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)but-2-enoate |
| SMILES | COC(=O)/C(=C(/C)NNC(=O)Nc1ccccc1)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C19H18N4O6S/c1-12(21-22-19(26)20-13-8-4-3-5-9-13)16(18(25)29-2)23-17(24)14-10-6-7-11-15(14)30(23,27)28/h3-11,21H,1-2H3,(H2,20,22,26)/b16-12+ |
| InChIKey | ORHINHLJKQNPQK-FOWTUZBSSA-N |
| XLogP | 1.56 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|