C15H11NO5S — CID 70586777
2-(3-methoxybenzoyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 70586777) has the molecular formula C15H11NO5S and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-(3-methoxybenzoyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(3-methoxybenzoyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 70586777 |
| Molecular Formula | C15H11NO5S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-(3-methoxybenzoyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | COc1cccc(C(=O)N2C(=O)c3ccccc3S2(=O)=O)c1 |
| InChI | InChI=1S/C15H11NO5S/c1-21-11-6-4-5-10(9-11)14(17)16-15(18)12-7-2-3-8-13(12)22(16,19)20/h2-9H,1H3 |
| InChIKey | SRTFQUSJIRFAPW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|