C15H11NO3Se — CID 162652693
2-(3-methoxybenzoyl)-1,2-benzoselenazol-3-one (PubChem CID 162652693) has the molecular formula C15H11NO3Se and a molecular weight of 332.22 g/mol. Its IUPAC name is 2-(3-methoxybenzoyl)-1,2-benzoselenazol-3-one.
| Compound Name | 2-(3-methoxybenzoyl)-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 162652693 |
| Molecular Formula | C15H11NO3Se |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 2-(3-methoxybenzoyl)-1,2-benzoselenazol-3-one |
| SMILES | COc1cccc(C(=O)n2[se]c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C15H11NO3Se/c1-19-11-6-4-5-10(9-11)14(17)16-15(18)12-7-2-3-8-13(12)20-16/h2-9H,1H3 |
| InChIKey | BWPGCIYPLUBMJJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|