About sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide
sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide (PubChem CID 18779399) has the molecular formula C14H13NaO3
and a molecular weight of 252.25 g/mol. Its IUPAC name is sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide.
Molecular Properties
| Compound Name | sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide |
| PubChem CID | 18779399 |
| Molecular Formula | C14H13NaO3 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide |
| SMILES | COc1cccc(C(=O)c2ccccc2)c1.[Na+].[OH-] |
| InChI | InChI=1S/C14H12O2.Na.H2O/c1-16-13-9-5-8-12(10-13)14(15)11-6-3-2-4-7-11;;/h2-10H,1H3;;1H2/q;+1;/p-1 |
| InChIKey | VJHZNYIRLHFNNQ-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide?
The IUPAC name of sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide (CID 18779399) is sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide.
What is the SMILES notation for sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide?
The canonical SMILES for sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide is COc1cccc(C(=O)c2ccccc2)c1.[Na+].[OH-].
What is the InChIKey of sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide?
The InChIKey is VJHZNYIRLHFNNQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H12O2.Na.H2O/c1-16-13-9-5-8-12(10-13)14(15)11-6-3-2-4-7-11;;/h2-10H,1H3;;1H2/q;+1;/p-1.
What are the key properties of sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide?
sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide has a molecular weight of 252.25 g/mol, XLogP of -0.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(3-methoxyphenyl)-phenylmethanone;hydroxide is sourced from PubChem (CID 18779399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).