C10H8N2O4S — CID 68655253
2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)prop-2-enamide (PubChem CID 68655253) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 68655253 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)prop-2-enamide |
| SMILES | C=C(C(N)=O)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C10H8N2O4S/c1-6(9(11)13)12-10(14)7-4-2-3-5-8(7)17(12,15)16/h2-5H,1H2,(H2,11,13) |
| InChIKey | CDMGHEJLMPDMIA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|