C11H9NO5S — CID 134239638
prop-2-enyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate (PubChem CID 134239638) has the molecular formula C11H9NO5S and a molecular weight of 267.26 g/mol. Its IUPAC name is prop-2-enyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate.
| Compound Name | prop-2-enyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate |
|---|---|
| PubChem CID | 134239638 |
| Molecular Formula | C11H9NO5S |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | prop-2-enyl 1,1,3-trioxo-1,2-benzothiazole-2-carboxylate |
| SMILES | C=CCOC(=O)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C11H9NO5S/c1-2-7-17-11(14)12-10(13)8-5-3-4-6-9(8)18(12,15)16/h2-6H,1,7H2 |
| InChIKey | DGVLAWDTCDGCDG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|