C15H10ClNO4S — CID 175283369
2-[2-(4-chlorophenyl)acetyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 175283369) has the molecular formula C15H10ClNO4S and a molecular weight of 335.77 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)acetyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[2-(4-chlorophenyl)acetyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 175283369 |
| Molecular Formula | C15H10ClNO4S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 2-[2-(4-chlorophenyl)acetyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C15H10ClNO4S/c16-11-7-5-10(6-8-11)9-14(18)17-15(19)12-3-1-2-4-13(12)22(17,20)21/h1-8H,9H2 |
| InChIKey | LYHGYNOECPMLPE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |