C13H15NO4S — CID 67684629
2-(2-ethylbutanoyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 67684629) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 2-(2-ethylbutanoyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(2-ethylbutanoyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 67684629 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-(2-ethylbutanoyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CCC(CC)C(=O)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C13H15NO4S/c1-3-9(4-2)12(15)14-13(16)10-7-5-6-8-11(10)19(14,17)18/h5-9H,3-4H2,1-2H3 |
| InChIKey | QWKKYIAZAKETCG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |