C13H8N2O9S2 — CID 159970746
1-(6-methyl-2,2,4-trioxooxathiazin-3-yl)-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethane-1,2-dione (PubChem CID 159970746) has the molecular formula C13H8N2O9S2 and a molecular weight of 400.35 g/mol. Its IUPAC name is 1-(6-methyl-2,2,4-trioxooxathiazin-3-yl)-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethane-1,2-dione.
| Compound Name | 1-(6-methyl-2,2,4-trioxooxathiazin-3-yl)-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 159970746 |
| Molecular Formula | C13H8N2O9S2 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 1-(6-methyl-2,2,4-trioxooxathiazin-3-yl)-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)ethane-1,2-dione |
| SMILES | CC1=CC(=O)N(C(=O)C(=O)N2C(=O)c3ccccc3S2(=O)=O)S(=O)(=O)O1 |
| InChI | InChI=1S/C13H8N2O9S2/c1-7-6-10(16)14(26(22,23)24-7)12(18)13(19)15-11(17)8-4-2-3-5-9(8)25(15,20)21/h2-6H,1H3 |
| InChIKey | XMPKJIICLXBUJD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 152.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|