C15H9ClN2O3 — CID 3120454
N-(4-chlorophenyl)-2,3-dioxoindole-1-carboxamide (PubChem CID 3120454) has the molecular formula C15H9ClN2O3 and a molecular weight of 300.70 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,3-dioxoindole-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2,3-dioxoindole-1-carboxamide |
|---|---|
| PubChem CID | 3120454 |
| Molecular Formula | C15H9ClN2O3 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-(4-chlorophenyl)-2,3-dioxoindole-1-carboxamide |
| SMILES | O=C1C(=O)N(C(=O)Nc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C15H9ClN2O3/c16-9-5-7-10(8-6-9)17-15(21)18-12-4-2-1-3-11(12)13(19)14(18)20/h1-8H,(H,17,21) |
| InChIKey | IGEUYBOUFWFNKH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|