C15H10N2O3 — CID 3582125
2,3-dioxo-N-phenylindole-1-carboxamide (PubChem CID 3582125) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2,3-dioxo-N-phenylindole-1-carboxamide.
| Compound Name | 2,3-dioxo-N-phenylindole-1-carboxamide |
|---|---|
| PubChem CID | 3582125 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2,3-dioxo-N-phenylindole-1-carboxamide |
| SMILES | O=C1C(=O)N(C(=O)Nc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H10N2O3/c18-13-11-8-4-5-9-12(11)17(14(13)19)15(20)16-10-6-2-1-3-7-10/h1-9H,(H,16,20) |
| InChIKey | OYJNIYAGHTZTMD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|