C17H18N4O2 — CID 2831867
3,3-dimethyl-1-N,2-N-diphenyldiaziridine-1,2-dicarboxamide (PubChem CID 2831867) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-N,2-N-diphenyldiaziridine-1,2-dicarboxamide.
| Compound Name | 3,3-dimethyl-1-N,2-N-diphenyldiaziridine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 2831867 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3,3-dimethyl-1-N,2-N-diphenyldiaziridine-1,2-dicarboxamide |
| SMILES | CC1(C)N(C(=O)Nc2ccccc2)N1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H18N4O2/c1-17(2)20(15(22)18-13-9-5-3-6-10-13)21(17)16(23)19-14-11-7-4-8-12-14/h3-12H,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | UCVXMMSXTKZVMB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|