C64H92N8O8Si — CID 88736179
tetrakis[2,2,6,6-tetramethyl-1-(phenylcarbamoyl)piperidin-4-yl] silicate (PubChem CID 88736179) has the molecular formula C64H92N8O8Si and a molecular weight of 1129.57 g/mol. Its IUPAC name is tetrakis[2,2,6,6-tetramethyl-1-(phenylcarbamoyl)piperidin-4-yl] silicate.
| Compound Name | tetrakis[2,2,6,6-tetramethyl-1-(phenylcarbamoyl)piperidin-4-yl] silicate |
|---|---|
| PubChem CID | 88736179 |
| Molecular Formula | C64H92N8O8Si |
| Molecular Weight | 1129.57 g/mol |
| Exact Mass | 1128.68 |
| IUPAC Name | tetrakis[2,2,6,6-tetramethyl-1-(phenylcarbamoyl)piperidin-4-yl] silicate |
| SMILES | CC1(C)CC(O[Si](OC2CC(C)(C)N(C(=O)Nc3ccccc3)C(C)(C)C2)(OC2CC(C)(C)N(C(=O)Nc3ccccc3)C(C)(C)C2)OC2CC(C)(C)N(C(=O)Nc3ccccc3)C(C)(C)C2)CC(C)(C)N1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C64H92N8O8Si/c1-57(2)37-49(38-58(3,4)69(57)53(73)65-45-29-21-17-22-30-45)77-81(78-50-39-59(5,6)70(60(7,8)40-50)54(74)66-46-31-23-18-24-32-46,79-51-41-61(9,10)71(62(11,12)42-51)55(75)67-47-33-25-19-26-34-47)80-52-43-63(13,14)72(64(15,16)44-52)56(76)68-48-35-27-20-28-36-48/h17-36,49-52H,37-44H2,1-16H3,(H,65,73)(H,66,74)(H,67,75)(H,68,76) |
| InChIKey | BHVNYVBAJFVHRA-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1129.57 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|