C23H32N2O3 — CID 124726741
[(1R,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 1-(phenylcarbamoyl)piperidine-4-carboxylate (PubChem CID 124726741) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(1R,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 1-(phenylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | [(1R,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 1-(phenylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 124726741 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | [(1R,2R,3R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] 1-(phenylcarbamoyl)piperidine-4-carboxylate |
| SMILES | C[C@@H]1[C@H]2C[C@H](C[C@H]1OC(=O)C1CCN(C(=O)Nc3ccccc3)CC1)C2(C)C |
| InChI | InChI=1S/C23H32N2O3/c1-15-19-13-17(23(19,2)3)14-20(15)28-21(26)16-9-11-25(12-10-16)22(27)24-18-7-5-4-6-8-18/h4-8,15-17,19-20H,9-14H2,1-3H3,(H,24,27)/t15-,17-,19-,20-/m1/s1 |
| InChIKey | CJGSJLGOYGVJOU-RARDXLECSA-N |
| XLogP | 4.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |