C22H31N3O4 — CID 42902325
[1-(cyclohexylamino)-1-oxopropan-2-yl] 1-(phenylcarbamoyl)piperidine-4-carboxylate (PubChem CID 42902325) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 1-(phenylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 1-(phenylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42902325 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 1-(phenylcarbamoyl)piperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(C(=O)Nc2ccccc2)CC1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H31N3O4/c1-16(20(26)23-18-8-4-2-5-9-18)29-21(27)17-12-14-25(15-13-17)22(28)24-19-10-6-3-7-11-19/h3,6-7,10-11,16-18H,2,4-5,8-9,12-15H2,1H3,(H,23,26)(H,24,28) |
| InChIKey | AYODZSUJGWGKRJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |