C26H35N3O4 — CID 30803642
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 1-(phenylcarbamoyl)piperidine-4-carboxylate (PubChem CID 30803642) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 1-(phenylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 1-(phenylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 30803642 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 1-(phenylcarbamoyl)piperidine-4-carboxylate |
| SMILES | C[C@@H](OC(=O)C1CCN(C(=O)Nc2ccccc2)CC1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H35N3O4/c1-17(23(30)28-26-14-18-11-19(15-26)13-20(12-18)16-26)33-24(31)21-7-9-29(10-8-21)25(32)27-22-5-3-2-4-6-22/h2-6,17-21H,7-16H2,1H3,(H,27,32)(H,28,30)/t17-,18?,19?,20?,26?/m1/s1 |
| InChIKey | YWHPPUPUJXMDQS-ZFGQVMFLSA-N |
| XLogP | 3.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |