C19H29NO3 — CID 8020130
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] cyclopentanecarboxylate (PubChem CID 8020130) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] cyclopentanecarboxylate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 8020130 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] cyclopentanecarboxylate |
| SMILES | C[C@H](OC(=O)C1CCCC1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H29NO3/c1-12(23-18(22)16-4-2-3-5-16)17(21)20-19-9-13-6-14(10-19)8-15(7-13)11-19/h12-16H,2-11H2,1H3,(H,20,21)/t12-,13?,14?,15?,19?/m0/s1 |
| InChIKey | VQYQXPGMQRDZNH-UHSVVUDUSA-N |
| XLogP | 3.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |