C19H27NO5 — CID 7851689
4-O-[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 1-O-ethyl (E)-but-2-enedioate (PubChem CID 7851689) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-O-[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 7851689 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-O-[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)O[C@@H](C)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H27NO5/c1-3-24-16(21)4-5-17(22)25-12(2)18(23)20-19-9-13-6-14(10-19)8-15(7-13)11-19/h4-5,12-15H,3,6-11H2,1-2H3,(H,20,23)/b5-4+/t12-,13?,14?,15?,19?/m0/s1 |
| InChIKey | PUUQDYSFHDDVHC-YHLQWGJOSA-N |
| XLogP | 2.12 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|