C17H25NO3 — CID 8673137
[2-(1-adamantylamino)-2-oxoethyl] (E)-pent-2-enoate (PubChem CID 8673137) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] (E)-pent-2-enoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 8673137 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H25NO3/c1-2-3-4-16(20)21-11-15(19)18-17-8-12-5-13(9-17)7-14(6-12)10-17/h3-4,12-14H,2,5-11H2,1H3,(H,18,19)/b4-3+ |
| InChIKey | NRARGQIDRZNBGU-ONEGZZNKSA-N |
| XLogP | 2.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|