C21H24ClNO3 — CID 4801681
[2-(1-adamantylamino)-2-oxoethyl] 3-(4-chlorophenyl)prop-2-enoate (PubChem CID 4801681) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4801681 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 3-(4-chlorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(Cl)cc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H24ClNO3/c22-18-4-1-14(2-5-18)3-6-20(25)26-13-19(24)23-21-10-15-7-16(11-21)9-17(8-15)12-21/h1-6,15-17H,7-13H2,(H,23,24) |
| InChIKey | UPKWSYGCBFRPPO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|