C22H25Cl2NO3 — CID 7873981
[2-(1-adamantylmethylamino)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 7873981) has the molecular formula C22H25Cl2NO3 and a molecular weight of 422.35 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7873981 |
| Molecular Formula | C22H25Cl2NO3 |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(Cl)cc1Cl)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H25Cl2NO3/c23-18-3-1-17(19(24)8-18)2-4-21(27)28-12-20(26)25-13-22-9-14-5-15(10-22)7-16(6-14)11-22/h1-4,8,14-16H,5-7,9-13H2,(H,25,26)/b4-2+ |
| InChIKey | QIDQFEGAUCSDSQ-DUXPYHPUSA-N |
| XLogP | 4.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|