C26H34N2O7S — CID 6110421
[2-(1-adamantylamino)-2-oxoethyl] (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 6110421) has the molecular formula C26H34N2O7S and a molecular weight of 518.63 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6110421 |
| Molecular Formula | C26H34N2O7S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)NC23CC4CC(CC(C4)C2)C3)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H34N2O7S/c1-33-22-4-2-18(13-23(22)36(31,32)28-6-8-34-9-7-28)3-5-25(30)35-17-24(29)27-26-14-19-10-20(15-26)12-21(11-19)16-26/h2-5,13,19-21H,6-12,14-17H2,1H3,(H,27,29)/b5-3+ |
| InChIKey | QCTZNDNGUWDXPQ-HWKANZROSA-N |
| XLogP | 2.36 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|