C21H22FNO6S — CID 18277205
(3-fluorophenyl)methyl (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 18277205) has the molecular formula C21H22FNO6S and a molecular weight of 435.47 g/mol. Its IUPAC name is (3-fluorophenyl)methyl (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | (3-fluorophenyl)methyl (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18277205 |
| Molecular Formula | C21H22FNO6S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (3-fluorophenyl)methyl (E)-3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCc2cccc(F)c2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H22FNO6S/c1-27-19-7-5-16(14-20(19)30(25,26)23-9-11-28-12-10-23)6-8-21(24)29-15-17-3-2-4-18(22)13-17/h2-8,13-14H,9-12,15H2,1H3/b8-6+ |
| InChIKey | UMHMYJCJDUPPNZ-SOFGYWHQSA-N |
| XLogP | 2.61 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|