C24H25N3O8S — CID 4027660
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate (PubChem CID 4027660) has the molecular formula C24H25N3O8S and a molecular weight of 515.54 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4027660 |
| Molecular Formula | C24H25N3O8S |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OCC(=O)N2CC(=O)Nc3ccccc32)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H25N3O8S/c1-33-20-8-6-17(14-21(20)36(31,32)26-10-12-34-13-11-26)7-9-24(30)35-16-23(29)27-15-22(28)25-18-4-2-3-5-19(18)27/h2-9,14H,10-13,15-16H2,1H3,(H,25,28) |
| InChIKey | WQOYOYOJBGWOKD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|