C19H15FN2O4 — CID 4035522
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-(4-fluorophenyl)prop-2-enoate (PubChem CID 4035522) has the molecular formula C19H15FN2O4 and a molecular weight of 354.34 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4035522 |
| Molecular Formula | C19H15FN2O4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 3-(4-fluorophenyl)prop-2-enoate |
| SMILES | O=C1CN(C(=O)COC(=O)C=Cc2ccc(F)cc2)c2ccccc2N1 |
| InChI | InChI=1S/C19H15FN2O4/c20-14-8-5-13(6-9-14)7-10-19(25)26-12-18(24)22-11-17(23)21-15-3-1-2-4-16(15)22/h1-10H,11-12H2,(H,21,23) |
| InChIKey | LHJKLUDYHFVAEN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|