C21H19FN2O4 — CID 43023432
[2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 43023432) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 43023432 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [2-(4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl)-2-oxoethyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | CC1CC(=O)Nc2ccccc2N1C(=O)COC(=O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C21H19FN2O4/c1-14-11-19(25)23-17-7-2-3-8-18(17)24(14)20(26)13-28-21(27)10-9-15-5-4-6-16(22)12-15/h2-10,12,14H,11,13H2,1H3,(H,23,25)/b10-9+ |
| InChIKey | DKFXZAATZHEMLR-MDZDMXLPSA-N |
| XLogP | 3.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|