C20H24N2O4 — CID 97022687
[2-[(4R)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl] 2-cyclohexylideneacetate (PubChem CID 97022687) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [2-[(4R)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl] 2-cyclohexylideneacetate.
| Compound Name | [2-[(4R)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl] 2-cyclohexylideneacetate |
|---|---|
| PubChem CID | 97022687 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [2-[(4R)-4-methyl-2-oxo-3,4-dihydro-1H-1,5-benzodiazepin-5-yl]-2-oxoethyl] 2-cyclohexylideneacetate |
| SMILES | C[C@@H]1CC(=O)Nc2ccccc2N1C(=O)COC(=O)C=C1CCCCC1 |
| InChI | InChI=1S/C20H24N2O4/c1-14-11-18(23)21-16-9-5-6-10-17(16)22(14)19(24)13-26-20(25)12-15-7-3-2-4-8-15/h5-6,9-10,12,14H,2-4,7-8,11,13H2,1H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | DBNJRBQIDJOAFC-CQSZACIVSA-N |
| XLogP | 3.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|