C20H15F3N2O4 — CID 7355456
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 7355456) has the molecular formula C20H15F3N2O4 and a molecular weight of 404.34 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7355456 |
| Molecular Formula | C20H15F3N2O4 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C1CN(C(=O)COC(=O)/C=C/c2ccc(C(F)(F)F)cc2)c2ccccc2N1 |
| InChI | InChI=1S/C20H15F3N2O4/c21-20(22,23)14-8-5-13(6-9-14)7-10-19(28)29-12-18(27)25-11-17(26)24-15-3-1-2-4-16(15)25/h1-10H,11-12H2,(H,24,26)/b10-7+ |
| InChIKey | DDSNVDMOFBVIDR-JXMROGBWSA-N |
| XLogP | 3.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|