C21H16F3N3O5 — CID 3907000
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]benzoate (PubChem CID 3907000) has the molecular formula C21H16F3N3O5 and a molecular weight of 447.37 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]benzoate.
| Compound Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]benzoate |
|---|---|
| PubChem CID | 3907000 |
| Molecular Formula | C21H16F3N3O5 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 2-[(4,4,4-trifluoro-3-oxobut-1-enyl)amino]benzoate |
| SMILES | O=C1CN(C(=O)COC(=O)c2ccccc2NC=CC(=O)C(F)(F)F)c2ccccc2N1 |
| InChI | InChI=1S/C21H16F3N3O5/c22-21(23,24)17(28)9-10-25-14-6-2-1-5-13(14)20(31)32-12-19(30)27-11-18(29)26-15-7-3-4-8-16(15)27/h1-10,25H,11-12H2,(H,26,29) |
| InChIKey | ALXFOAZVKSSVKD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|