C19H15F3N2O4 — CID 7953850
(2-anilino-2-oxoethyl) 2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoate (PubChem CID 7953850) has the molecular formula C19H15F3N2O4 and a molecular weight of 392.33 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoate.
| Compound Name | (2-anilino-2-oxoethyl) 2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 7953850 |
| Molecular Formula | C19H15F3N2O4 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-[[(E)-4,4,4-trifluoro-3-oxobut-1-enyl]amino]benzoate |
| SMILES | O=C(COC(=O)c1ccccc1N/C=C/C(=O)C(F)(F)F)Nc1ccccc1 |
| InChI | InChI=1S/C19H15F3N2O4/c20-19(21,22)16(25)10-11-23-15-9-5-4-8-14(15)18(27)28-12-17(26)24-13-6-2-1-3-7-13/h1-11,23H,12H2,(H,24,26)/b11-10+ |
| InChIKey | DHTXMYAUTKEKMB-ZHACJKMWSA-N |
| XLogP | 3.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|