C19H20Cl3NO3 — CID 5032959
[2-(1-adamantylamino)-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 5032959) has the molecular formula C19H20Cl3NO3 and a molecular weight of 416.73 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 5032959 |
| Molecular Formula | C19H20Cl3NO3 |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)ccc(Cl)c1Cl)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H20Cl3NO3/c20-13-1-2-14(21)17(22)16(13)18(25)26-9-15(24)23-19-6-10-3-11(7-19)5-12(4-10)8-19/h1-2,10-12H,3-9H2,(H,23,24) |
| InChIKey | UDYAARSDOATKMT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|