C19H21ClN2O5 — CID 7471389
[2-(1-adamantylamino)-2-oxoethyl] 4-chloro-3-nitrobenzoate (PubChem CID 7471389) has the molecular formula C19H21ClN2O5 and a molecular weight of 392.84 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 7471389 |
| Molecular Formula | C19H21ClN2O5 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 4-chloro-3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H21ClN2O5/c20-15-2-1-14(6-16(15)22(25)26)18(24)27-10-17(23)21-19-7-11-3-12(8-19)5-13(4-11)9-19/h1-2,6,11-13H,3-5,7-10H2,(H,21,23) |
| InChIKey | SUHJRLRVMDXQPP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|