C19H12Cl4N2O8 — CID 2129487
[(1S,3R)-2,2-dichloro-3-[(4-chloro-3-nitrobenzoyl)oxymethyl]cyclopropyl]methyl 4-chloro-3-nitrobenzoate (PubChem CID 2129487) has the molecular formula C19H12Cl4N2O8 and a molecular weight of 538.12 g/mol. Its IUPAC name is [(1S,3R)-2,2-dichloro-3-[(4-chloro-3-nitrobenzoyl)oxymethyl]cyclopropyl]methyl 4-chloro-3-nitrobenzoate.
| Compound Name | [(1S,3R)-2,2-dichloro-3-[(4-chloro-3-nitrobenzoyl)oxymethyl]cyclopropyl]methyl 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 2129487 |
| Molecular Formula | C19H12Cl4N2O8 |
| Molecular Weight | 538.12 g/mol |
| Exact Mass | 535.93 |
| IUPAC Name | [(1S,3R)-2,2-dichloro-3-[(4-chloro-3-nitrobenzoyl)oxymethyl]cyclopropyl]methyl 4-chloro-3-nitrobenzoate |
| SMILES | O=C(OC[C@@H]1[C@H](COC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C1(Cl)Cl)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12Cl4N2O8/c20-13-3-1-9(5-15(13)24(28)29)17(26)32-7-11-12(19(11,22)23)8-33-18(27)10-2-4-14(21)16(6-10)25(30)31/h1-6,11-12H,7-8H2/t11-,12+ |
| InChIKey | FGJGHSIDLZJXNM-TXEJJXNPSA-N |
| XLogP | 5.24 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.12 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|