C25H25Cl3N2O5S — CID 25035072
[2-(1-adamantylamino)-2-oxoethyl] 4-chloro-3-[(2,5-dichlorophenyl)sulfamoyl]benzoate (PubChem CID 25035072) has the molecular formula C25H25Cl3N2O5S and a molecular weight of 571.91 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] 4-chloro-3-[(2,5-dichlorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] 4-chloro-3-[(2,5-dichlorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25035072 |
| Molecular Formula | C25H25Cl3N2O5S |
| Molecular Weight | 571.91 g/mol |
| Exact Mass | 570.05 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] 4-chloro-3-[(2,5-dichlorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(S(=O)(=O)Nc2cc(Cl)ccc2Cl)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H25Cl3N2O5S/c26-18-2-4-19(27)21(9-18)30-36(33,34)22-8-17(1-3-20(22)28)24(32)35-13-23(31)29-25-10-14-5-15(11-25)7-16(6-14)12-25/h1-4,8-9,14-16,30H,5-7,10-13H2,(H,29,31) |
| InChIKey | NOIFUCMJLLHMCB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.91 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |