C15H11Cl2FN2O5S — CID 16537917
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 16537917) has the molecular formula C15H11Cl2FN2O5S and a molecular weight of 421.23 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16537917 |
| Molecular Formula | C15H11Cl2FN2O5S |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OCC(=O)Nc2cc(Cl)ccc2F)ccc1Cl |
| InChI | InChI=1S/C15H11Cl2FN2O5S/c16-9-2-4-11(18)12(6-9)20-14(21)7-25-15(22)8-1-3-10(17)13(5-8)26(19,23)24/h1-6H,7H2,(H,20,21)(H2,19,23,24) |
| InChIKey | SGMUWUJIAOWWAA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |