C16H11ClF3N3O7S — CID 55317641
[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 55317641) has the molecular formula C16H11ClF3N3O7S and a molecular weight of 481.79 g/mol. Its IUPAC name is [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55317641 |
| Molecular Formula | C16H11ClF3N3O7S |
| Molecular Weight | 481.79 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H11ClF3N3O7S/c17-11-3-1-8(5-13(11)31(21,28)29)15(25)30-7-14(24)22-12-4-2-9(23(26)27)6-10(12)16(18,19)20/h1-6H,7H2,(H,22,24)(H2,21,28,29) |
| InChIKey | OTNHLJOHWAICMM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.79 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|