C19H21ClN2O5S — CID 2615233
[2-(2,6-diethylanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 2615233) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is [2-(2,6-diethylanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [2-(2,6-diethylanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 2615233 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [2-(2,6-diethylanilino)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | CCc1cccc(CC)c1NC(=O)COC(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C19H21ClN2O5S/c1-3-12-6-5-7-13(4-2)18(12)22-17(23)11-27-19(24)14-8-9-15(20)16(10-14)28(21,25)26/h5-10H,3-4,11H2,1-2H3,(H,22,23)(H2,21,25,26) |
| InChIKey | SPMSBNOIYHPYEN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |