C18H17ClN2O6S — CID 16568901
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 16568901) has the molecular formula C18H17ClN2O6S and a molecular weight of 424.86 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16568901 |
| Molecular Formula | C18H17ClN2O6S |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C18H17ClN2O6S/c1-2-17(23)21-13-6-3-11(4-7-13)15(22)10-27-18(24)12-5-8-14(19)16(9-12)28(20,25)26/h3-9H,2,10H2,1H3,(H,21,23)(H2,20,25,26) |
| InChIKey | LZHOAXLOBUAWIB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |