C22H17ClN2O6S — CID 16569415
[2-(4-benzamidophenyl)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate (PubChem CID 16569415) has the molecular formula C22H17ClN2O6S and a molecular weight of 472.91 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16569415 |
| Molecular Formula | C22H17ClN2O6S |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] 4-chloro-3-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OCC(=O)c2ccc(NC(=O)c3ccccc3)cc2)ccc1Cl |
| InChI | InChI=1S/C22H17ClN2O6S/c23-18-11-8-16(12-20(18)32(24,29)30)22(28)31-13-19(26)14-6-9-17(10-7-14)25-21(27)15-4-2-1-3-5-15/h1-12H,13H2,(H,25,27)(H2,24,29,30) |
| InChIKey | WQSCVCZLOZHCJX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |