C17H14ClNO6S — CID 41423260
(2-benzamido-2-oxoethyl) 4-chloro-3-methylsulfonylbenzoate (PubChem CID 41423260) has the molecular formula C17H14ClNO6S and a molecular weight of 395.82 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-chloro-3-methylsulfonylbenzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 4-chloro-3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 41423260 |
| Molecular Formula | C17H14ClNO6S |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-chloro-3-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1cc(C(=O)OCC(=O)NC(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C17H14ClNO6S/c1-26(23,24)14-9-12(7-8-13(14)18)17(22)25-10-15(20)19-16(21)11-5-3-2-4-6-11/h2-9H,10H2,1H3,(H,19,20,21) |
| InChIKey | OWDQZXQMKOLIHK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |